C10H14F3N2O6P — CID 11610136
[3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxymethylphosphonic acid (PubChem CID 11610136) has the molecular formula C10H14F3N2O6P and a molecular weight of 346.20 g/mol. Its IUPAC name is [3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxymethylphosphonic acid.
| Compound Name | [3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 11610136 |
| Molecular Formula | C10H14F3N2O6P |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | [3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxymethylphosphonic acid |
| SMILES | CCc1cn(CC(OCP(=O)(O)O)C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14F3N2O6P/c1-2-6-3-15(9(17)14-8(6)16)4-7(10(11,12)13)21-5-22(18,19)20/h3,7H,2,4-5H2,1H3,(H,14,16,17)(H2,18,19,20) |
| InChIKey | KFCFAUDHENQEAL-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|