C9H13F2N2O5P — CID 57342704
[1,1-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl]phosphonic acid (PubChem CID 57342704) has the molecular formula C9H13F2N2O5P and a molecular weight of 298.18 g/mol. Its IUPAC name is [1,1-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl]phosphonic acid.
| Compound Name | [1,1-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl]phosphonic acid |
|---|---|
| PubChem CID | 57342704 |
| Molecular Formula | C9H13F2N2O5P |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [1,1-difluoro-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl]phosphonic acid |
| SMILES | Cc1cn(CCCC(F)(F)P(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13F2N2O5P/c1-6-5-13(8(15)12-7(6)14)4-2-3-9(10,11)19(16,17)18/h5H,2-4H2,1H3,(H,12,14,15)(H2,16,17,18) |
| InChIKey | URUBKMCSAVRMLG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|