C20H30ClN3O3S — CID 11611651
tert-butyl 4-[2-[(E)-[(S)-tert-butylsulfinyl]iminomethyl]-6-chlorophenyl]piperazine-1-carboxylate (PubChem CID 11611651) has the molecular formula C20H30ClN3O3S and a molecular weight of 428.00 g/mol. Its IUPAC name is tert-butyl 4-[2-[(E)-[(S)-tert-butylsulfinyl]iminomethyl]-6-chlorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(E)-[(S)-tert-butylsulfinyl]iminomethyl]-6-chlorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11611651 |
| Molecular Formula | C20H30ClN3O3S |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | tert-butyl 4-[2-[(E)-[(S)-tert-butylsulfinyl]iminomethyl]-6-chlorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(Cl)cccc2/C=N/[S@@](=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H30ClN3O3S/c1-19(2,3)27-18(25)24-12-10-23(11-13-24)17-15(8-7-9-16(17)21)14-22-28(26)20(4,5)6/h7-9,14H,10-13H2,1-6H3/b22-14+/t28-/m0/s1 |
| InChIKey | SBGIOGSWYZAERD-IKIXNTAXSA-N |
| XLogP | 4.28 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|