C23H31ClN4O4S — CID 162434310
tert-butyl 4-[2-[[amino-(2-methylphenyl)sulfonylamino]methyl]-6-chlorophenyl]piperazine-1-carboxylate (PubChem CID 162434310) has the molecular formula C23H31ClN4O4S and a molecular weight of 495.05 g/mol. Its IUPAC name is tert-butyl 4-[2-[[amino-(2-methylphenyl)sulfonylamino]methyl]-6-chlorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[amino-(2-methylphenyl)sulfonylamino]methyl]-6-chlorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162434310 |
| Molecular Formula | C23H31ClN4O4S |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | tert-butyl 4-[2-[[amino-(2-methylphenyl)sulfonylamino]methyl]-6-chlorophenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccccc1S(=O)(=O)N(N)Cc1cccc(Cl)c1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H31ClN4O4S/c1-17-8-5-6-11-20(17)33(30,31)28(25)16-18-9-7-10-19(24)21(18)26-12-14-27(15-13-26)22(29)32-23(2,3)4/h5-11H,12-16,25H2,1-4H3 |
| InChIKey | ANTIZUANYKBKJU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|