C26H29NO4S — CID 11612149
(6aR,9aR)-1,7,7,9,9-pentamethyl-3-(4-methylphenyl)sulfonyl-9a,10-dihydro-6aH-[2]benzofuro[6,5-e]indol-6-one (PubChem CID 11612149) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is (6aR,9aR)-1,7,7,9,9-pentamethyl-3-(4-methylphenyl)sulfonyl-9a,10-dihydro-6aH-[2]benzofuro[6,5-e]indol-6-one.
| Compound Name | (6aR,9aR)-1,7,7,9,9-pentamethyl-3-(4-methylphenyl)sulfonyl-9a,10-dihydro-6aH-[2]benzofuro[6,5-e]indol-6-one |
|---|---|
| PubChem CID | 11612149 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (6aR,9aR)-1,7,7,9,9-pentamethyl-3-(4-methylphenyl)sulfonyl-9a,10-dihydro-6aH-[2]benzofuro[6,5-e]indol-6-one |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C)c3c4c(ccc32)C(=O)[C@@H]2[C@@H](C4)C(C)(C)OC2(C)C)cc1 |
| InChI | InChI=1S/C26H29NO4S/c1-15-7-9-17(10-8-15)32(29,30)27-14-16(2)22-19-13-20-23(26(5,6)31-25(20,3)4)24(28)18(19)11-12-21(22)27/h7-12,14,20,23H,13H2,1-6H3/t20-,23+/m1/s1 |
| InChIKey | NOHDDBRWKXSONL-OFNKIYASSA-N |
| XLogP | 5.05 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |