C27H26N2O5S — CID 54732358
(2R,3S)-5-acetyl-4-hydroxy-8,8-dimethyl-16-(4-methylphenyl)sulfonyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),4,11(18),12,14-pentaen-6-one (PubChem CID 54732358) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is (2R,3S)-5-acetyl-4-hydroxy-8,8-dimethyl-16-(4-methylphenyl)sulfonyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),4,11(18),12,14-pentaen-6-one.
| Compound Name | (2R,3S)-5-acetyl-4-hydroxy-8,8-dimethyl-16-(4-methylphenyl)sulfonyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),4,11(18),12,14-pentaen-6-one |
|---|---|
| PubChem CID | 54732358 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (2R,3S)-5-acetyl-4-hydroxy-8,8-dimethyl-16-(4-methylphenyl)sulfonyl-7,16-diazapentacyclo[9.6.1.02,9.03,7.015,18]octadeca-1(17),4,11(18),12,14-pentaen-6-one |
| SMILES | CC(=O)C1=C(O)[C@@H]2[C@H]3c4cn(S(=O)(=O)c5ccc(C)cc5)c5cccc(c45)CC3C(C)(C)N2C1=O |
| InChI | InChI=1S/C27H26N2O5S/c1-14-8-10-17(11-9-14)35(33,34)28-13-18-22-16(6-5-7-20(22)28)12-19-23(18)24-25(31)21(15(2)30)26(32)29(24)27(19,3)4/h5-11,13,19,23-24,31H,12H2,1-4H3/t19?,23-,24-/m0/s1 |
| InChIKey | IVWXKKAAIGUTLE-SXZQLXHWSA-N |
| XLogP | 3.85 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|