C17H21NO5S — CID 141259117
8-(4-methylphenyl)sulfonyl-2,3,4a,5,7,7a,9,10-octahydro-[1,4]dioxino[2,3-d]indol-6-one (PubChem CID 141259117) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 8-(4-methylphenyl)sulfonyl-2,3,4a,5,7,7a,9,10-octahydro-[1,4]dioxino[2,3-d]indol-6-one.
| Compound Name | 8-(4-methylphenyl)sulfonyl-2,3,4a,5,7,7a,9,10-octahydro-[1,4]dioxino[2,3-d]indol-6-one |
|---|---|
| PubChem CID | 141259117 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 8-(4-methylphenyl)sulfonyl-2,3,4a,5,7,7a,9,10-octahydro-[1,4]dioxino[2,3-d]indol-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC34OCCOC3CC(=O)CC24)cc1 |
| InChI | InChI=1S/C17H21NO5S/c1-12-2-4-14(5-3-12)24(20,21)18-7-6-17-15(18)10-13(19)11-16(17)22-8-9-23-17/h2-5,15-16H,6-11H2,1H3 |
| InChIKey | PQEIVTATSWLQEP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |