C28H29NO6 — CID 11612596
ethyl 2-cyano-2-[(7R,11S)-3,3-dimethyl-1,5-dioxo-7,11-diphenyl-2,4-dioxaspiro[5.5]undecan-9-yl]acetate (PubChem CID 11612596) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is ethyl 2-cyano-2-[(7R,11S)-3,3-dimethyl-1,5-dioxo-7,11-diphenyl-2,4-dioxaspiro[5.5]undecan-9-yl]acetate.
| Compound Name | ethyl 2-cyano-2-[(7R,11S)-3,3-dimethyl-1,5-dioxo-7,11-diphenyl-2,4-dioxaspiro[5.5]undecan-9-yl]acetate |
|---|---|
| PubChem CID | 11612596 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | ethyl 2-cyano-2-[(7R,11S)-3,3-dimethyl-1,5-dioxo-7,11-diphenyl-2,4-dioxaspiro[5.5]undecan-9-yl]acetate |
| SMILES | CCOC(=O)C(C#N)C1C[C@H](c2ccccc2)C2(C(=O)OC(C)(C)OC2=O)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C28H29NO6/c1-4-33-24(30)21(17-29)20-15-22(18-11-7-5-8-12-18)28(23(16-20)19-13-9-6-10-14-19)25(31)34-27(2,3)35-26(28)32/h5-14,20-23H,4,15-16H2,1-3H3/t20?,21?,22-,23+ |
| InChIKey | KMFLZYYUMCRBKQ-MYNGYRLFSA-N |
| XLogP | 4.49 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|