C31H51NO4Si2 — CID 11613771
(4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,4-dimethyl-5-triethylsilyloxyhexanamide (PubChem CID 11613771) has the molecular formula C31H51NO4Si2 and a molecular weight of 557.92 g/mol. Its IUPAC name is (4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,4-dimethyl-5-triethylsilyloxyhexanamide.
| Compound Name | (4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,4-dimethyl-5-triethylsilyloxyhexanamide |
|---|---|
| PubChem CID | 11613771 |
| Molecular Formula | C31H51NO4Si2 |
| Molecular Weight | 557.92 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | (4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,4-dimethyl-5-triethylsilyloxyhexanamide |
| SMILES | CC[Si](CC)(CC)O[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CCC(=O)N(C)OC |
| InChI | InChI=1S/C31H51NO4Si2/c1-10-37(11-2,12-3)36-29(26(4)23-24-30(33)32(8)34-9)25-35-38(31(5,6)7,27-19-15-13-16-20-27)28-21-17-14-18-22-28/h13-22,26,29H,10-12,23-25H2,1-9H3/t26-,29-/m0/s1 |
| InChIKey | GRHLOUWQNGQFAA-WNJJXGMVSA-N |
| XLogP | 6.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.92 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|