C34H59NO5Si3 — CID 134958709
(3R,5S)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,3-dimethyl-5-triethylsilyloxy-3-trimethylsilyloxyhexanamide (PubChem CID 134958709) has the molecular formula C34H59NO5Si3 and a molecular weight of 646.11 g/mol. Its IUPAC name is (3R,5S)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,3-dimethyl-5-triethylsilyloxy-3-trimethylsilyloxyhexanamide.
| Compound Name | (3R,5S)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,3-dimethyl-5-triethylsilyloxy-3-trimethylsilyloxyhexanamide |
|---|---|
| PubChem CID | 134958709 |
| Molecular Formula | C34H59NO5Si3 |
| Molecular Weight | 646.11 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | (3R,5S)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,3-dimethyl-5-triethylsilyloxy-3-trimethylsilyloxyhexanamide |
| SMILES | CC[Si](CC)(CC)O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@](C)(CC(=O)N(C)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C34H59NO5Si3/c1-13-42(14-2,15-3)39-29(26-34(7,40-41(10,11)12)27-32(36)35(8)37-9)28-38-43(33(4,5)6,30-22-18-16-19-23-30)31-24-20-17-21-25-31/h16-25,29H,13-15,26-28H2,1-12H3/t29-,34+/m0/s1 |
| InChIKey | WLAUHWANDAAQFF-ZBWWXOROSA-N |
| XLogP | 7.36 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.11 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|