C30H47NO4Si — CID 46844799
(3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-N,5-dimethoxy-N,3-dimethyldecanamide (PubChem CID 46844799) has the molecular formula C30H47NO4Si and a molecular weight of 513.80 g/mol. Its IUPAC name is (3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-N,5-dimethoxy-N,3-dimethyldecanamide.
| Compound Name | (3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-N,5-dimethoxy-N,3-dimethyldecanamide |
|---|---|
| PubChem CID | 46844799 |
| Molecular Formula | C30H47NO4Si |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.33 |
| IUPAC Name | (3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-N,5-dimethoxy-N,3-dimethyldecanamide |
| SMILES | CCC[C@H](C[C@@H](C[C@@H](C)CC(=O)N(C)OC)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H47NO4Si/c1-9-16-25(23-26(33-7)21-24(2)22-29(32)31(6)34-8)35-36(30(3,4)5,27-17-12-10-13-18-27)28-19-14-11-15-20-28/h10-15,17-20,24-26H,9,16,21-23H2,1-8H3/t24-,25-,26-/m1/s1 |
| InChIKey | SCTNWGZDWASWHT-TWJOJJKGSA-N |
| XLogP | 5.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|