C33H49NO5Si — CID 58077852
(4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-oxooxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide (PubChem CID 58077852) has the molecular formula C33H49NO5Si and a molecular weight of 567.84 g/mol. Its IUPAC name is (4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-oxooxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide.
| Compound Name | (4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-oxooxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide |
|---|---|
| PubChem CID | 58077852 |
| Molecular Formula | C33H49NO5Si |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | (4R)-6-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-oxooxolan-2-yl]-N-methoxy-N,2,4-trimethylhexanamide |
| SMILES | CON(C)C(=O)C(C)C[C@H](C)CCC1O[C@@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C33H49NO5Si/c1-25(23-26(2)32(36)34(6)37-7)20-21-31-30(35)24-27(39-31)15-14-22-38-40(33(3,4)5,28-16-10-8-11-17-28)29-18-12-9-13-19-29/h8-13,16-19,25-27,31H,14-15,20-24H2,1-7H3/t25-,26?,27+,31?/m1/s1 |
| InChIKey | CCRIIOAVTJMRLL-FDHSGUKKSA-N |
| XLogP | 5.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|