C29H45NO4Si — CID 46844244
(3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N-methoxy-N,3-dimethyldecanamide (PubChem CID 46844244) has the molecular formula C29H45NO4Si and a molecular weight of 499.77 g/mol. Its IUPAC name is (3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N-methoxy-N,3-dimethyldecanamide.
| Compound Name | (3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N-methoxy-N,3-dimethyldecanamide |
|---|---|
| PubChem CID | 46844244 |
| Molecular Formula | C29H45NO4Si |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | (3R,5R,7R)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-N-methoxy-N,3-dimethyldecanamide |
| SMILES | CCC[C@H](C[C@H](O)C[C@@H](C)CC(=O)N(C)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H45NO4Si/c1-8-15-25(22-24(31)20-23(2)21-28(32)30(6)33-7)34-35(29(3,4)5,26-16-11-9-12-17-26)27-18-13-10-14-19-27/h9-14,16-19,23-25,31H,8,15,20-22H2,1-7H3/t23-,24-,25-/m1/s1 |
| InChIKey | SIZSFSQFKFHUAQ-UBFVSLLYSA-N |
| XLogP | 4.92 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|