C24H35NO6Si — CID 10790196
(3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3,4,5-trihydroxy-N-methoxy-N-methylhexanamide (PubChem CID 10790196) has the molecular formula C24H35NO6Si and a molecular weight of 461.63 g/mol. Its IUPAC name is (3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3,4,5-trihydroxy-N-methoxy-N-methylhexanamide.
| Compound Name | (3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3,4,5-trihydroxy-N-methoxy-N-methylhexanamide |
|---|---|
| PubChem CID | 10790196 |
| Molecular Formula | C24H35NO6Si |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3,4,5-trihydroxy-N-methoxy-N-methylhexanamide |
| SMILES | CON(C)C(=O)C[C@@H](O)[C@H](O)[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H35NO6Si/c1-24(2,3)32(18-12-8-6-9-13-18,19-14-10-7-11-15-19)31-17-21(27)23(29)20(26)16-22(28)25(4)30-5/h6-15,20-21,23,26-27,29H,16-17H2,1-5H3/t20-,21-,23+/m1/s1 |
| InChIKey | YTJBTNVCKBTEGP-XPNTWCBSSA-N |
| XLogP | 1.06 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|