C28H45NO4Si2 — CID 42604024
(2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-3-trimethylsilyloxypentanamide (PubChem CID 42604024) has the molecular formula C28H45NO4Si2 and a molecular weight of 515.84 g/mol. Its IUPAC name is (2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-3-trimethylsilyloxypentanamide.
| Compound Name | (2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-3-trimethylsilyloxypentanamide |
|---|---|
| PubChem CID | 42604024 |
| Molecular Formula | C28H45NO4Si2 |
| Molecular Weight | 515.84 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | (2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-3-trimethylsilyloxypentanamide |
| SMILES | CON(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H45NO4Si2/c1-22(26(33-34(8,9)10)23(2)27(30)29(6)31-7)21-32-35(28(3,4)5,24-17-13-11-14-18-24)25-19-15-12-16-20-25/h11-20,22-23,26H,21H2,1-10H3/t22-,23+,26-/m0/s1 |
| InChIKey | NUQIGFSDXNSQPR-ZEVJAHDQSA-N |
| XLogP | 5.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|