C19H30O3 — CID 11616494
(6R,8R,10Z,12aS)-8-(methoxymethoxy)-6,10,12a-trimethyl-1,2,5,6,7,8,9,12-octahydrocyclopenta[11]annulen-4-one (PubChem CID 11616494) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (6R,8R,10Z,12aS)-8-(methoxymethoxy)-6,10,12a-trimethyl-1,2,5,6,7,8,9,12-octahydrocyclopenta[11]annulen-4-one.
| Compound Name | (6R,8R,10Z,12aS)-8-(methoxymethoxy)-6,10,12a-trimethyl-1,2,5,6,7,8,9,12-octahydrocyclopenta[11]annulen-4-one |
|---|---|
| PubChem CID | 11616494 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (6R,8R,10Z,12aS)-8-(methoxymethoxy)-6,10,12a-trimethyl-1,2,5,6,7,8,9,12-octahydrocyclopenta[11]annulen-4-one |
| SMILES | COCO[C@H]1C/C(C)=C\C[C@]2(C)CCC=C2C(=O)C[C@H](C)C1 |
| InChI | InChI=1S/C19H30O3/c1-14-7-9-19(3)8-5-6-17(19)18(20)12-15(2)11-16(10-14)22-13-21-4/h6-7,15-16H,5,8-13H2,1-4H3/b14-7-/t15-,16+,19+/m1/s1 |
| InChIKey | FUXASOFLQBXJSL-MMNWSIGXSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|