C17H28O — CID 11627971
(3S)-3-oct-7-en-4-yn-3-yloxynon-1-ene (PubChem CID 11627971) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (3S)-3-oct-7-en-4-yn-3-yloxynon-1-ene.
| Compound Name | (3S)-3-oct-7-en-4-yn-3-yloxynon-1-ene |
|---|---|
| PubChem CID | 11627971 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (3S)-3-oct-7-en-4-yn-3-yloxynon-1-ene |
| SMILES | C=CCC#CC(CC)O[C@H](C=C)CCCCCC |
| InChI | InChI=1S/C17H28O/c1-5-9-11-13-15-17(8-4)18-16(7-3)14-12-10-6-2/h6,8,16-17H,2,4-5,7,9-11,13,15H2,1,3H3/t16?,17-/m1/s1 |
| InChIKey | SXPIIAAOUFCSJJ-ZYMOGRSISA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|