C22H30O5S — CID 11640082
(1S,2S,7S,7aS)-2-methoxy-7-(methoxymethoxy)-3,3,7a-trimethyl-1-phenylsulfanyl-1,5,6,7-tetrahydroindene-2-carboxylic acid (PubChem CID 11640082) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is (1S,2S,7S,7aS)-2-methoxy-7-(methoxymethoxy)-3,3,7a-trimethyl-1-phenylsulfanyl-1,5,6,7-tetrahydroindene-2-carboxylic acid.
| Compound Name | (1S,2S,7S,7aS)-2-methoxy-7-(methoxymethoxy)-3,3,7a-trimethyl-1-phenylsulfanyl-1,5,6,7-tetrahydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 11640082 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (1S,2S,7S,7aS)-2-methoxy-7-(methoxymethoxy)-3,3,7a-trimethyl-1-phenylsulfanyl-1,5,6,7-tetrahydroindene-2-carboxylic acid |
| SMILES | COCO[C@H]1CCC=C2C(C)(C)[C@](OC)(C(=O)O)[C@@H](Sc3ccccc3)[C@@]21C |
| InChI | InChI=1S/C22H30O5S/c1-20(2)16-12-9-13-17(27-14-25-4)21(16,3)18(22(20,26-5)19(23)24)28-15-10-7-6-8-11-15/h6-8,10-12,17-18H,9,13-14H2,1-5H3,(H,23,24)/t17-,18-,21-,22+/m0/s1 |
| InChIKey | RFAICNJGVIUWDF-YHDSQAASSA-N |
| XLogP | 4.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|