C29H33N5O6 — CID 11642444
2-hydroxyethyl(trimethyl)azanium;4-[[6-[(4-methoxyphenyl)methylcarbamoyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoate (PubChem CID 11642444) has the molecular formula C29H33N5O6 and a molecular weight of 547.61 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;4-[[6-[(4-methoxyphenyl)methylcarbamoyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoate.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;4-[[6-[(4-methoxyphenyl)methylcarbamoyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 11642444 |
| Molecular Formula | C29H33N5O6 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;4-[[6-[(4-methoxyphenyl)methylcarbamoyl]-4-oxopyrido[3,4-d]pyrimidin-3-yl]methyl]benzoate |
| SMILES | COc1ccc(CNC(=O)c2cc3c(=O)n(Cc4ccc(C(=O)[O-])cc4)cnc3cn2)cc1.C[N+](C)(C)CCO |
| InChI | InChI=1S/C24H20N4O5.C5H14NO/c1-33-18-8-4-15(5-9-18)11-26-22(29)20-10-19-21(12-25-20)27-14-28(23(19)30)13-16-2-6-17(7-3-16)24(31)32;1-6(2,3)4-5-7/h2-10,12,14H,11,13H2,1H3,(H,26,29)(H,31,32);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | IICITGANEDFATQ-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|