C18H36O4Si — CID 11645897
ethyl (E,6S,7S)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,6-dimethyloct-2-enoate (PubChem CID 11645897) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is ethyl (E,6S,7S)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,6-dimethyloct-2-enoate.
| Compound Name | ethyl (E,6S,7S)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,6-dimethyloct-2-enoate |
|---|---|
| PubChem CID | 11645897 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | ethyl (E,6S,7S)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,6-dimethyloct-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@H](C)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-9-21-17(20)15(3)12-10-11-14(2)16(19)13-22-23(7,8)18(4,5)6/h12,14,16,19H,9-11,13H2,1-8H3/b15-12+/t14-,16+/m0/s1 |
| InChIKey | SAZYWLVEHXSGFH-FVQZFCNMSA-N |
| XLogP | 4.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|