C21H38O5Si — CID 134962316
(2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-trimethylsilyloxytetradeca-2,5,8-trienoic acid (PubChem CID 134962316) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-trimethylsilyloxytetradeca-2,5,8-trienoic acid.
| Compound Name | (2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-trimethylsilyloxytetradeca-2,5,8-trienoic acid |
|---|---|
| PubChem CID | 134962316 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (2E,4R,5E,7S,8E,12S,13R)-13-hydroxy-7-methoxy-4,8,12-trimethyl-4-trimethylsilyloxytetradeca-2,5,8-trienoic acid |
| SMILES | CO[C@@H](/C=C/[C@](C)(/C=C/C(=O)O)O[Si](C)(C)C)/C(C)=C/CC[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C21H38O5Si/c1-16(18(3)22)10-9-11-17(2)19(25-5)12-14-21(4,15-13-20(23)24)26-27(6,7)8/h11-16,18-19,22H,9-10H2,1-8H3,(H,23,24)/b14-12+,15-13+,17-11+/t16-,18+,19-,21+/m0/s1 |
| InChIKey | BPASBLAFEWAAAJ-ZAGYSDORSA-N |
| XLogP | 4.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|