C20H17F2N5O2 — CID 11646939
4-[5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]-N-(3-imidazol-1-ylpropyl)-1H-pyrrole-2-carboxamide (PubChem CID 11646939) has the molecular formula C20H17F2N5O2 and a molecular weight of 397.39 g/mol. Its IUPAC name is 4-[5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]-N-(3-imidazol-1-ylpropyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]-N-(3-imidazol-1-ylpropyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 11646939 |
| Molecular Formula | C20H17F2N5O2 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-[5-(2,3-difluorophenyl)-1,2-oxazol-4-yl]-N-(3-imidazol-1-ylpropyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cc(-c2cnoc2-c2cccc(F)c2F)c[nH]1 |
| InChI | InChI=1S/C20H17F2N5O2/c21-16-4-1-3-14(18(16)22)19-15(11-26-29-19)13-9-17(25-10-13)20(28)24-5-2-7-27-8-6-23-12-27/h1,3-4,6,8-12,25H,2,5,7H2,(H,24,28) |
| InChIKey | ZUKJOZDYFMXWMM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|