C27H20ClF3N4O3 — CID 11649571
(E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[2-(4-methoxyanilino)pyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 11649571) has the molecular formula C27H20ClF3N4O3 and a molecular weight of 540.93 g/mol. Its IUPAC name is (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[2-(4-methoxyanilino)pyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[2-(4-methoxyanilino)pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11649571 |
| Molecular Formula | C27H20ClF3N4O3 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[2-(4-methoxyanilino)pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(Nc2nccc(Oc3cccc(/C=C/C(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)c3)n2)cc1 |
| InChI | InChI=1S/C27H20ClF3N4O3/c1-37-20-9-6-18(7-10-20)34-26-32-14-13-25(35-26)38-21-4-2-3-17(15-21)5-12-24(36)33-19-8-11-23(28)22(16-19)27(29,30)31/h2-16H,1H3,(H,33,36)(H,32,34,35)/b12-5+ |
| InChIKey | SILGHSRZCCCRLD-LFYBBSHMSA-N |
| XLogP | 7.35 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|