C21H17Cl3N4O6S2 — CID 11650062
2-[2-(4-hydroxy-3-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 11650062) has the molecular formula C21H17Cl3N4O6S2 and a molecular weight of 591.88 g/mol. Its IUPAC name is 2-[2-(4-hydroxy-3-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-(4-hydroxy-3-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 11650062 |
| Molecular Formula | C21H17Cl3N4O6S2 |
| Molecular Weight | 591.88 g/mol |
| Exact Mass | 589.97 |
| IUPAC Name | 2-[2-(4-hydroxy-3-methoxyphenyl)-4-oxo-3-[5-sulfanylidene-3-[(2,4,6-trichlorophenoxy)methyl]-1H-1,2,4-triazol-4-yl]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(C2SC(CC(=O)O)C(=O)N2n2c(COc3c(Cl)cc(Cl)cc3Cl)n[nH]c2=S)ccc1O |
| InChI | InChI=1S/C21H17Cl3N4O6S2/c1-33-14-4-9(2-3-13(14)29)20-28(19(32)15(36-20)7-17(30)31)27-16(25-26-21(27)35)8-34-18-11(23)5-10(22)6-12(18)24/h2-6,15,20,29H,7-8H2,1H3,(H,26,35)(H,30,31) |
| InChIKey | UASFKZHEMUOTAQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|