C14H21ClN2OS — CID 116503809
4-chloro-3-(3-ethylsulfanylpropylamino)-N,N-dimethylbenzamide (PubChem CID 116503809) has the molecular formula C14H21ClN2OS and a molecular weight of 300.86 g/mol. Its IUPAC name is 4-chloro-3-(3-ethylsulfanylpropylamino)-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-3-(3-ethylsulfanylpropylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 116503809 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-chloro-3-(3-ethylsulfanylpropylamino)-N,N-dimethylbenzamide |
| SMILES | CCSCCCNc1cc(C(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C14H21ClN2OS/c1-4-19-9-5-8-16-13-10-11(6-7-12(13)15)14(18)17(2)3/h6-7,10,16H,4-5,8-9H2,1-3H3 |
| InChIKey | ANPXDYFNBRSHMO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|