C9H18N6 — CID 116515831
1-amino-2-(2-methylpropyl)-3-(1-methylpyrazol-3-yl)guanidine (PubChem CID 116515831) has the molecular formula C9H18N6 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-amino-2-(2-methylpropyl)-3-(1-methylpyrazol-3-yl)guanidine.
| Compound Name | 1-amino-2-(2-methylpropyl)-3-(1-methylpyrazol-3-yl)guanidine |
|---|---|
| PubChem CID | 116515831 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1-amino-2-(2-methylpropyl)-3-(1-methylpyrazol-3-yl)guanidine |
| SMILES | CC(C)C/N=C(\NN)Nc1ccn(C)n1 |
| InChI | InChI=1S/C9H18N6/c1-7(2)6-11-9(13-10)12-8-4-5-15(3)14-8/h4-5,7H,6,10H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | PETQFNKFUJHLNK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|