C10H19ClOS — CID 116525754
5-(3-chloropropylsulfanylmethyl)-2,2-dimethyloxolane (PubChem CID 116525754) has the molecular formula C10H19ClOS and a molecular weight of 222.78 g/mol. Its IUPAC name is 5-(3-chloropropylsulfanylmethyl)-2,2-dimethyloxolane.
| Compound Name | 5-(3-chloropropylsulfanylmethyl)-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116525754 |
| Molecular Formula | C10H19ClOS |
| Molecular Weight | 222.78 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-(3-chloropropylsulfanylmethyl)-2,2-dimethyloxolane |
| SMILES | CC1(C)CCC(CSCCCCl)O1 |
| InChI | InChI=1S/C10H19ClOS/c1-10(2)5-4-9(12-10)8-13-7-3-6-11/h9H,3-8H2,1-2H3 |
| InChIKey | JUFCEKMNIQCSBU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|