C11H10ClF — CID 116532144
2-chloro-9-fluorotricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene (PubChem CID 116532144) has the molecular formula C11H10ClF and a molecular weight of 196.65 g/mol. Its IUPAC name is 2-chloro-9-fluorotricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene.
| Compound Name | 2-chloro-9-fluorotricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene |
|---|---|
| PubChem CID | 116532144 |
| Molecular Formula | C11H10ClF |
| Molecular Weight | 196.65 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2-chloro-9-fluorotricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene |
| SMILES | Fc1cc2c3c(c1)C(Cl)CC3CC2 |
| InChI | InChI=1S/C11H10ClF/c12-10-4-7-2-1-6-3-8(13)5-9(10)11(6)7/h3,5,7,10H,1-2,4H2 |
| InChIKey | FYEOJRYYEZYGHE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|