About (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one
(2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one (PubChem CID 11653768) has the molecular formula C22H18ClNO3
and a molecular weight of 379.84 g/mol. Its IUPAC name is (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one.
Molecular Properties
| Compound Name | (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one |
| PubChem CID | 11653768 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one |
| SMILES | COc1cc2cc(/C=C3\Cc4c(C)cccc4C3=O)c(Cl)nc2cc1OC |
| InChI | InChI=1S/C22H18ClNO3/c1-12-5-4-6-16-17(12)9-14(21(16)25)8-15-7-13-10-19(26-2)20(27-3)11-18(13)24-22(15)23/h4-8,10-11H,9H2,1-3H3/b14-8+ |
| InChIKey | YTRVNBPMMSWTBC-RIYZIHGNSA-N |
| XLogP | 5.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one?
The IUPAC name of (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one (CID 11653768) is (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one.
What is the SMILES notation for (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one?
The canonical SMILES for (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one is COc1cc2cc(/C=C3\Cc4c(C)cccc4C3=O)c(Cl)nc2cc1OC.
What is the InChIKey of (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one?
The InChIKey is YTRVNBPMMSWTBC-RIYZIHGNSA-N. The full InChI is InChI=1S/C22H18ClNO3/c1-12-5-4-6-16-17(12)9-14(21(16)25)8-15-7-13-10-19(26-2)20(27-3)11-18(13)24-22(15)23/h4-8,10-11H,9H2,1-3H3/b14-8+.
What are the key properties of (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one?
(2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one has a molecular weight of 379.84 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-4-methyl-3H-inden-1-one is sourced from PubChem (CID 11653768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).