C15H21Cl — CID 116540374
2-[(3-chloro-1-methylcyclopentyl)methyl]-1,3-dimethylbenzene (PubChem CID 116540374) has the molecular formula C15H21Cl and a molecular weight of 236.79 g/mol. Its IUPAC name is 2-[(3-chloro-1-methylcyclopentyl)methyl]-1,3-dimethylbenzene.
| Compound Name | 2-[(3-chloro-1-methylcyclopentyl)methyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 116540374 |
| Molecular Formula | C15H21Cl |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(3-chloro-1-methylcyclopentyl)methyl]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1CC1(C)CCC(Cl)C1 |
| InChI | InChI=1S/C15H21Cl/c1-11-5-4-6-12(2)14(11)10-15(3)8-7-13(16)9-15/h4-6,13H,7-10H2,1-3H3 |
| InChIKey | PUKIVOJMBKGYPR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|