C31H35NO5 — CID 11656295
[(2R,3S,4R)-4-cyano-1,3,4-tris(phenylmethoxy)butan-2-yl] 2,2-dimethylpropanoate (PubChem CID 11656295) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is [(2R,3S,4R)-4-cyano-1,3,4-tris(phenylmethoxy)butan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R)-4-cyano-1,3,4-tris(phenylmethoxy)butan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11656295 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [(2R,3S,4R)-4-cyano-1,3,4-tris(phenylmethoxy)butan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C#N)OCc1ccccc1 |
| InChI | InChI=1S/C31H35NO5/c1-31(2,3)30(33)37-28(23-34-20-24-13-7-4-8-14-24)29(36-22-26-17-11-6-12-18-26)27(19-32)35-21-25-15-9-5-10-16-25/h4-18,27-29H,20-23H2,1-3H3/t27-,28-,29+/m1/s1 |
| InChIKey | CIYAQNCZTQLYPZ-NLDZOOGBSA-N |
| XLogP | 5.86 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |