About 3-aminoundecan-5-one
3-aminoundecan-5-one (PubChem CID 116609089) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 3-aminoundecan-5-one.
Molecular Properties
| Compound Name | 3-aminoundecan-5-one |
| PubChem CID | 116609089 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 3-aminoundecan-5-one |
| SMILES | CCCCCCC(=O)CC(N)CC |
| InChI | InChI=1S/C11H23NO/c1-3-5-6-7-8-11(13)9-10(12)4-2/h10H,3-9,12H2,1-2H3 |
| InChIKey | CVYSWRIAYGHQEP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminoundecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoundecan-5-one?
The IUPAC name of 3-aminoundecan-5-one (CID 116609089) is 3-aminoundecan-5-one.
What is the SMILES notation for 3-aminoundecan-5-one?
The canonical SMILES for 3-aminoundecan-5-one is CCCCCCC(=O)CC(N)CC.
What is the InChIKey of 3-aminoundecan-5-one?
The InChIKey is CVYSWRIAYGHQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-3-5-6-7-8-11(13)9-10(12)4-2/h10H,3-9,12H2,1-2H3.
What are the key properties of 3-aminoundecan-5-one?
3-aminoundecan-5-one has a molecular weight of 185.31 g/mol, XLogP of 2.65, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoundecan-5-one is sourced from PubChem (CID 116609089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).