C22H13F4N5OS — CID 1166112
2-[5-(4-fluorophenyl)tetrazol-2-yl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone (PubChem CID 1166112) has the molecular formula C22H13F4N5OS and a molecular weight of 471.44 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)tetrazol-2-yl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone.
| Compound Name | 2-[5-(4-fluorophenyl)tetrazol-2-yl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
|---|---|
| PubChem CID | 1166112 |
| Molecular Formula | C22H13F4N5OS |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2-[5-(4-fluorophenyl)tetrazol-2-yl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
| SMILES | O=C(Cn1nnc(-c2ccc(F)cc2)n1)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C22H13F4N5OS/c23-15-8-5-13(6-9-15)21-27-29-30(28-21)12-20(32)31-16-3-1-2-4-18(16)33-19-10-7-14(11-17(19)31)22(24,25)26/h1-11H,12H2 |
| InChIKey | LAOAOVSIWWWSDL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |