C24H27NO7S — CID 11662873
[(3R,5S)-5-benzoyl-5-methoxy-3-(methylsulfanylmethoxy)-2-oxo-4-phenylmethoxypyrrolidin-3-yl]methyl acetate (PubChem CID 11662873) has the molecular formula C24H27NO7S and a molecular weight of 473.55 g/mol. Its IUPAC name is [(3R,5S)-5-benzoyl-5-methoxy-3-(methylsulfanylmethoxy)-2-oxo-4-phenylmethoxypyrrolidin-3-yl]methyl acetate.
| Compound Name | [(3R,5S)-5-benzoyl-5-methoxy-3-(methylsulfanylmethoxy)-2-oxo-4-phenylmethoxypyrrolidin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 11662873 |
| Molecular Formula | C24H27NO7S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [(3R,5S)-5-benzoyl-5-methoxy-3-(methylsulfanylmethoxy)-2-oxo-4-phenylmethoxypyrrolidin-3-yl]methyl acetate |
| SMILES | CO[C@@]1(C(=O)c2ccccc2)NC(=O)[C@](COC(C)=O)(OCSC)C1OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO7S/c1-17(26)31-15-23(32-16-33-3)21(30-14-18-10-6-4-7-11-18)24(29-2,25-22(23)28)20(27)19-12-8-5-9-13-19/h4-13,21H,14-16H2,1-3H3,(H,25,28)/t21?,23-,24-/m1/s1 |
| InChIKey | VWXFYQNYCXRYNS-MXNGKVSJSA-N |
| XLogP | 2.57 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|