C35H39N3O5 — CID 11664266
(Z)-but-2-enedioic acid;5-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene (PubChem CID 11664266) has the molecular formula C35H39N3O5 and a molecular weight of 581.71 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;5-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene.
| Compound Name | (Z)-but-2-enedioic acid;5-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 11664266 |
| Molecular Formula | C35H39N3O5 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | (Z)-but-2-enedioic acid;5-methoxy-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indole;(1S,9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene |
| SMILES | COc1ccc2[nH]cc(C[C@H]3CCCN3C)c2c1.C[C@]12N[C@H](Cc3ccccc31)c1ccccc12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H15N.C15H20N2O.C4H4O4/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16;1-17-7-3-4-12(17)8-11-10-16-15-6-5-13(18-2)9-14(11)15;5-3(6)1-2-4(7)8/h2-9,15,17H,10H2,1H3;5-6,9-10,12,16H,3-4,7-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;;2-1-/t15-,16+;12-;/m11./s1 |
| InChIKey | ZLAVCGIYIHCLFW-TZPJXUCVSA-N |
| XLogP | 5.68 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|