C36H50O6S4 — CID 11664814
4-[2-[3-[3-[1-(4-carboxyphenyl)-1-oxooctan-2-yl]sulfanylpropyldisulfanyl]propylsulfanyl]octanoyl]benzoic acid (PubChem CID 11664814) has the molecular formula C36H50O6S4 and a molecular weight of 707.06 g/mol. Its IUPAC name is 4-[2-[3-[3-[1-(4-carboxyphenyl)-1-oxooctan-2-yl]sulfanylpropyldisulfanyl]propylsulfanyl]octanoyl]benzoic acid.
| Compound Name | 4-[2-[3-[3-[1-(4-carboxyphenyl)-1-oxooctan-2-yl]sulfanylpropyldisulfanyl]propylsulfanyl]octanoyl]benzoic acid |
|---|---|
| PubChem CID | 11664814 |
| Molecular Formula | C36H50O6S4 |
| Molecular Weight | 707.06 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | 4-[2-[3-[3-[1-(4-carboxyphenyl)-1-oxooctan-2-yl]sulfanylpropyldisulfanyl]propylsulfanyl]octanoyl]benzoic acid |
| SMILES | CCCCCCC(SCCCSSCCCSC(CCCCCC)C(=O)c1ccc(C(=O)O)cc1)C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C36H50O6S4/c1-3-5-7-9-13-31(33(37)27-15-19-29(20-16-27)35(39)40)43-23-11-25-45-46-26-12-24-44-32(14-10-8-6-4-2)34(38)28-17-21-30(22-18-28)36(41)42/h15-22,31-32H,3-14,23-26H2,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | CEAZZDLJYLIJOX-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.06 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|