C11H15N5O2S2 — CID 116668979
4-amino-2-(2-methoxyethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 116668979) has the molecular formula C11H15N5O2S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-amino-2-(2-methoxyethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(2-methoxyethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116668979 |
| Molecular Formula | C11H15N5O2S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-amino-2-(2-methoxyethylamino)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNc1nc(N)c(C(=O)Nc2nc(C)cs2)s1 |
| InChI | InChI=1S/C11H15N5O2S2/c1-6-5-19-11(14-6)16-9(17)7-8(12)15-10(20-7)13-3-4-18-2/h5H,3-4,12H2,1-2H3,(H,13,15)(H,14,16,17) |
| InChIKey | SRPXSGMMTLMHAL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|