C18H36O3Si — CID 11667050
ethyl (2R)-2-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopentyl]propanoate (PubChem CID 11667050) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is ethyl (2R)-2-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopentyl]propanoate.
| Compound Name | ethyl (2R)-2-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopentyl]propanoate |
|---|---|
| PubChem CID | 11667050 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | ethyl (2R)-2-[(1S,2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopentyl]propanoate |
| SMILES | CCOC(=O)[C@H](C)[C@H]1CC[C@H](C)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-9-20-17(19)14(3)15-11-10-13(2)16(15)12-21-22(7,8)18(4,5)6/h13-16H,9-12H2,1-8H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | IYJRGBSLQSMBJX-ZJIFWQFVSA-N |
| XLogP | 4.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|