C12H15N5O3 — CID 116678369
1-[1-[2-(azetidin-3-ylidene)propanoyl]azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 116678369) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-[1-[2-(azetidin-3-ylidene)propanoyl]azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-[2-(azetidin-3-ylidene)propanoyl]azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116678369 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-[1-[2-(azetidin-3-ylidene)propanoyl]azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | CC(C(=O)N1CC(n2cc(C(=O)O)nn2)C1)=C1CNC1 |
| InChI | InChI=1S/C12H15N5O3/c1-7(8-2-13-3-8)11(18)16-4-9(5-16)17-6-10(12(19)20)14-15-17/h6,9,13H,2-5H2,1H3,(H,19,20) |
| InChIKey | QMWPFHYWLJJMNH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|