C13H15FN6O8 — CID 11668504
(Z)-(4-ethoxycarbonylpiperazin-1-yl)-(5-fluoro-2,4-dinitrophenoxy)imino-oxidoazanium (PubChem CID 11668504) has the molecular formula C13H15FN6O8 and a molecular weight of 402.30 g/mol. Its IUPAC name is (Z)-(4-ethoxycarbonylpiperazin-1-yl)-(5-fluoro-2,4-dinitrophenoxy)imino-oxidoazanium.
| Compound Name | (Z)-(4-ethoxycarbonylpiperazin-1-yl)-(5-fluoro-2,4-dinitrophenoxy)imino-oxidoazanium |
|---|---|
| PubChem CID | 11668504 |
| Molecular Formula | C13H15FN6O8 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (Z)-(4-ethoxycarbonylpiperazin-1-yl)-(5-fluoro-2,4-dinitrophenoxy)imino-oxidoazanium |
| SMILES | CCOC(=O)N1CCN(/[N+]([O-])=N/Oc2cc(F)c([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H15FN6O8/c1-2-27-13(21)16-3-5-17(6-4-16)20(26)15-28-12-7-9(14)10(18(22)23)8-11(12)19(24)25/h7-8H,2-6H2,1H3/b20-15- |
| InChIKey | UGDNIZMKTPCSOS-HKWRFOASSA-N |
| XLogP | 1.59 |
| TPSA | 166.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|