C15H20N6O8 — CID 56833533
(Z)-(4-ethoxycarbonyl-1,4-diazepan-1-yl)-(5-methyl-2,4-dinitrophenoxy)imino-oxidoazanium (PubChem CID 56833533) has the molecular formula C15H20N6O8 and a molecular weight of 412.36 g/mol. Its IUPAC name is (Z)-(4-ethoxycarbonyl-1,4-diazepan-1-yl)-(5-methyl-2,4-dinitrophenoxy)imino-oxidoazanium.
| Compound Name | (Z)-(4-ethoxycarbonyl-1,4-diazepan-1-yl)-(5-methyl-2,4-dinitrophenoxy)imino-oxidoazanium |
|---|---|
| PubChem CID | 56833533 |
| Molecular Formula | C15H20N6O8 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (Z)-(4-ethoxycarbonyl-1,4-diazepan-1-yl)-(5-methyl-2,4-dinitrophenoxy)imino-oxidoazanium |
| SMILES | CCOC(=O)N1CCCN(/[N+]([O-])=N/Oc2cc(C)c([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H20N6O8/c1-3-28-15(22)17-5-4-6-18(8-7-17)21(27)16-29-14-9-11(2)12(19(23)24)10-13(14)20(25)26/h9-10H,3-8H2,1-2H3/b21-16- |
| InChIKey | DZTQNFLHGGCKHO-PGMHBOJBSA-N |
| XLogP | 2.15 |
| TPSA | 166.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|