C19H18Br2N2O — CID 11669575
5-[(4,5-dibromo-1H-pyrrol-2-yl)-(2,4,6-trimethylphenyl)methyl]-1H-pyrrole-2-carbaldehyde (PubChem CID 11669575) has the molecular formula C19H18Br2N2O and a molecular weight of 450.17 g/mol. Its IUPAC name is 5-[(4,5-dibromo-1H-pyrrol-2-yl)-(2,4,6-trimethylphenyl)methyl]-1H-pyrrole-2-carbaldehyde.
| Compound Name | 5-[(4,5-dibromo-1H-pyrrol-2-yl)-(2,4,6-trimethylphenyl)methyl]-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 11669575 |
| Molecular Formula | C19H18Br2N2O |
| Molecular Weight | 450.17 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | 5-[(4,5-dibromo-1H-pyrrol-2-yl)-(2,4,6-trimethylphenyl)methyl]-1H-pyrrole-2-carbaldehyde |
| SMILES | Cc1cc(C)c(C(c2ccc(C=O)[nH]2)c2cc(Br)c(Br)[nH]2)c(C)c1 |
| InChI | InChI=1S/C19H18Br2N2O/c1-10-6-11(2)17(12(3)7-10)18(15-5-4-13(9-24)22-15)16-8-14(20)19(21)23-16/h4-9,18,22-23H,1-3H3 |
| InChIKey | AIGMEDLWQPSHJJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.17 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|