C12H21NO2 — CID 116724444
1-(furan-2-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine (PubChem CID 116724444) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine.
| Compound Name | 1-(furan-2-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 116724444 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(furan-2-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine |
| SMILES | CNC(c1ccco1)C(OC)C(C)(C)C |
| InChI | InChI=1S/C12H21NO2/c1-12(2,3)11(14-5)10(13-4)9-7-6-8-15-9/h6-8,10-11,13H,1-5H3 |
| InChIKey | MGJZBHZLNPEZDZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |