C25H33NO2Si — CID 86718373
(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-(furan-2-yl)-N,2-dimethylpropan-1-amine (PubChem CID 86718373) has the molecular formula C25H33NO2Si and a molecular weight of 407.63 g/mol. Its IUPAC name is (1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-(furan-2-yl)-N,2-dimethylpropan-1-amine.
| Compound Name | (1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-(furan-2-yl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 86718373 |
| Molecular Formula | C25H33NO2Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-(furan-2-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CN[C@H](c1ccco1)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H33NO2Si/c1-20(24(26-5)23-17-12-18-27-23)19-28-29(25(2,3)4,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-18,20,24,26H,19H2,1-5H3/t20-,24-/m0/s1 |
| InChIKey | SBGAMWKQMXNUES-RDPSFJRHSA-N |
| XLogP | 4.75 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|