C11H8N2O3S3 — CID 11674022
4-(1,3-benzothiazol-2-yl)-N-hydroxythiophene-2-sulfonamide (PubChem CID 11674022) has the molecular formula C11H8N2O3S3 and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-hydroxythiophene-2-sulfonamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-hydroxythiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11674022 |
| Molecular Formula | C11H8N2O3S3 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-hydroxythiophene-2-sulfonamide |
| SMILES | O=S(=O)(NO)c1cc(-c2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C11H8N2O3S3/c14-13-19(15,16)10-5-7(6-17-10)11-12-8-3-1-2-4-9(8)18-11/h1-6,13-14H |
| InChIKey | UVJUJLBCHMCLPX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|