C17H18FN2OP — CID 11674330
2-[(1R,3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]-4-fluorophenol (PubChem CID 11674330) has the molecular formula C17H18FN2OP and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-[(1R,3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]-4-fluorophenol.
| Compound Name | 2-[(1R,3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]-4-fluorophenol |
|---|---|
| PubChem CID | 11674330 |
| Molecular Formula | C17H18FN2OP |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[(1R,3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]-4-fluorophenol |
| SMILES | Oc1ccc(F)cc1[P@@]1N(c2ccccc2)C[C@@H]2CCCN21 |
| InChI | InChI=1S/C17H18FN2OP/c18-13-8-9-16(21)17(11-13)22-19-10-4-7-15(19)12-20(22)14-5-2-1-3-6-14/h1-3,5-6,8-9,11,15,21H,4,7,10,12H2/t15-,22+/m0/s1 |
| InChIKey | CVNYQOINOGIFGO-OYHNWAKOSA-N |
| XLogP | 3.45 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|