C19H23N2O2P — CID 177458267
(3aS)-1-(2-methoxyphenyl)-2-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole (PubChem CID 177458267) has the molecular formula C19H23N2O2P and a molecular weight of 342.38 g/mol. Its IUPAC name is (3aS)-1-(2-methoxyphenyl)-2-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole.
| Compound Name | (3aS)-1-(2-methoxyphenyl)-2-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole |
|---|---|
| PubChem CID | 177458267 |
| Molecular Formula | C19H23N2O2P |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (3aS)-1-(2-methoxyphenyl)-2-(4-methoxyphenyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole |
| SMILES | COc1ccc(N2C[C@@H]3CCCN3P2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C19H23N2O2P/c1-22-17-11-9-15(10-12-17)21-14-16-6-5-13-20(16)24(21)19-8-4-3-7-18(19)23-2/h3-4,7-12,16H,5-6,13-14H2,1-2H3/t16-,24?/m0/s1 |
| InChIKey | PKONBNXNCZOUJO-FXIRQEPWSA-N |
| XLogP | 3.63 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|