C21H31N2OP — CID 101453662
(3aS)-2-phenyl-1-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole (PubChem CID 101453662) has the molecular formula C21H31N2OP and a molecular weight of 358.47 g/mol. Its IUPAC name is (3aS)-2-phenyl-1-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole.
| Compound Name | (3aS)-2-phenyl-1-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole |
|---|---|
| PubChem CID | 101453662 |
| Molecular Formula | C21H31N2OP |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (3aS)-2-phenyl-1-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](OP1N(c3ccccc3)C[C@@H]3CCCN31)C2 |
| InChI | InChI=1S/C21H31N2OP/c1-20(2)16-11-12-21(20,3)19(14-16)24-25-22-13-7-10-18(22)15-23(25)17-8-5-4-6-9-17/h4-6,8-9,16,18-19H,7,10-15H2,1-3H3/t16-,18-,19+,21+,25?/m0/s1 |
| InChIKey | UCEGBAFQHVDYHU-CBTMAMPUSA-N |
| XLogP | 5.43 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|