C14H21N2OP — CID 177398662
(3aS)-2-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole (PubChem CID 177398662) has the molecular formula C14H21N2OP and a molecular weight of 264.31 g/mol. Its IUPAC name is (3aS)-2-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole.
| Compound Name | (3aS)-2-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole |
|---|---|
| PubChem CID | 177398662 |
| Molecular Formula | C14H21N2OP |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3aS)-2-phenyl-1-propan-2-yloxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole |
| SMILES | CC(C)OP1N(c2ccccc2)C[C@@H]2CCCN21 |
| InChI | InChI=1S/C14H21N2OP/c1-12(2)17-18-15-10-6-9-14(15)11-16(18)13-7-4-3-5-8-13/h3-5,7-8,12,14H,6,9-11H2,1-2H3/t14-,18?/m0/s1 |
| InChIKey | ULCHGHFCXZODEV-PIVQAISJSA-N |
| XLogP | 3.62 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|