C29H36N4P2 — CID 161327823
(3aS)-1-[2-[(3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenyl]-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole;methane (PubChem CID 161327823) has the molecular formula C29H36N4P2 and a molecular weight of 502.58 g/mol. Its IUPAC name is (3aS)-1-[2-[(3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenyl]-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole;methane.
| Compound Name | (3aS)-1-[2-[(3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenyl]-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole;methane |
|---|---|
| PubChem CID | 161327823 |
| Molecular Formula | C29H36N4P2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (3aS)-1-[2-[(3aS)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenyl]-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole;methane |
| SMILES | C.c1ccc(N2C[C@@H]3CCCN3P2c2ccccc2P2N(c3ccccc3)C[C@@H]3CCCN32)cc1 |
| InChI | InChI=1S/C28H32N4P2.CH4/c1-3-11-23(12-4-1)31-21-25-15-9-19-29(25)33(31)27-17-7-8-18-28(27)34-30-20-10-16-26(30)22-32(34)24-13-5-2-6-14-24;/h1-8,11-14,17-18,25-26H,9-10,15-16,19-22H2;1H4/t25-,26-,33?,34?;/m0./s1 |
| InChIKey | VKZVWPGCXYIAJQ-WJLKOFJRSA-N |
| XLogP | 6.17 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|